C19H29FO — CID 101396581
(2S,3S,4S,6R)-4-fluoro-3-methyl-2-pentyl-6-(2-phenylethyl)oxane (PubChem CID 101396581) has the molecular formula C19H29FO and a molecular weight of 292.44 g/mol. Its IUPAC name is (2S,3S,4S,6R)-4-fluoro-3-methyl-2-pentyl-6-(2-phenylethyl)oxane.
| Compound Name | (2S,3S,4S,6R)-4-fluoro-3-methyl-2-pentyl-6-(2-phenylethyl)oxane |
|---|---|
| PubChem CID | 101396581 |
| Molecular Formula | C19H29FO |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (2S,3S,4S,6R)-4-fluoro-3-methyl-2-pentyl-6-(2-phenylethyl)oxane |
| SMILES | CCCCC[C@@H]1O[C@H](CCc2ccccc2)C[C@H](F)[C@H]1C |
| InChI | InChI=1S/C19H29FO/c1-3-4-6-11-19-15(2)18(20)14-17(21-19)13-12-16-9-7-5-8-10-16/h5,7-10,15,17-19H,3-4,6,11-14H2,1-2H3/t15-,17-,18+,19+/m1/s1 |
| InChIKey | BAVBAAQCTWFHFO-YSHGAJCASA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|