C16H29N4O+ — CID 101396628
(2S)-2-[3-[3-(1-azabicyclo[2.2.2]octan-3-ylamino)propyl]imidazol-3-ium-1-yl]propan-1-ol (PubChem CID 101396628) has the molecular formula C16H29N4O+ and a molecular weight of 293.44 g/mol. Its IUPAC name is (2S)-2-[3-[3-(1-azabicyclo[2.2.2]octan-3-ylamino)propyl]imidazol-3-ium-1-yl]propan-1-ol.
| Compound Name | (2S)-2-[3-[3-(1-azabicyclo[2.2.2]octan-3-ylamino)propyl]imidazol-3-ium-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 101396628 |
| Molecular Formula | C16H29N4O+ |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | (2S)-2-[3-[3-(1-azabicyclo[2.2.2]octan-3-ylamino)propyl]imidazol-3-ium-1-yl]propan-1-ol |
| SMILES | C[C@@H](CO)n1cc[n+](CCCNC2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C16H29N4O/c1-14(12-21)20-10-9-19(13-20)6-2-5-17-16-11-18-7-3-15(16)4-8-18/h9-10,13-17,21H,2-8,11-12H2,1H3/q+1/t14-,16?/m0/s1 |
| InChIKey | PHPLTKMLVTVNKH-LBAUFKAWSA-N |
| XLogP | 0.40 |
| TPSA | 44.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|