C13H18NO2P — CID 101397054
(4aS,8aR)-2-phenyl-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinine 2-oxide (PubChem CID 101397054) has the molecular formula C13H18NO2P and a molecular weight of 251.27 g/mol. Its IUPAC name is (4aS,8aR)-2-phenyl-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinine 2-oxide.
| Compound Name | (4aS,8aR)-2-phenyl-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinine 2-oxide |
|---|---|
| PubChem CID | 101397054 |
| Molecular Formula | C13H18NO2P |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (4aS,8aR)-2-phenyl-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinine 2-oxide |
| SMILES | O=P1(c2ccccc2)N[C@@H]2CCCC[C@@H]2CO1 |
| InChI | InChI=1S/C13H18NO2P/c15-17(12-7-2-1-3-8-12)14-13-9-5-4-6-11(13)10-16-17/h1-3,7-8,11,13H,4-6,9-10H2,(H,14,15)/t11-,13-,17?/m1/s1 |
| InChIKey | MUSKYBCHMKBRDH-MURHOUPQSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|