C24H24N4O9 — CID 101397212
N-[2-[bis[2-[(4-oxopyran-2-carbonyl)amino]ethyl]amino]ethyl]-4-oxopyran-2-carboxamide (PubChem CID 101397212) has the molecular formula C24H24N4O9 and a molecular weight of 512.48 g/mol. Its IUPAC name is N-[2-[bis[2-[(4-oxopyran-2-carbonyl)amino]ethyl]amino]ethyl]-4-oxopyran-2-carboxamide.
| Compound Name | N-[2-[bis[2-[(4-oxopyran-2-carbonyl)amino]ethyl]amino]ethyl]-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 101397212 |
| Molecular Formula | C24H24N4O9 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | N-[2-[bis[2-[(4-oxopyran-2-carbonyl)amino]ethyl]amino]ethyl]-4-oxopyran-2-carboxamide |
| SMILES | O=C(NCCN(CCNC(=O)c1cc(=O)cco1)CCNC(=O)c1cc(=O)cco1)c1cc(=O)cco1 |
| InChI | InChI=1S/C24H24N4O9/c29-16-1-10-35-19(13-16)22(32)25-4-7-28(8-5-26-23(33)20-14-17(30)2-11-36-20)9-6-27-24(34)21-15-18(31)3-12-37-21/h1-3,10-15H,4-9H2,(H,25,32)(H,26,33)(H,27,34) |
| InChIKey | PWEQCSSAYNUSHY-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 181.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |