C21H34O3Si — CID 101397283
(1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5-dimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol (PubChem CID 101397283) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5-dimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol.
| Compound Name | (1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5-dimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol |
|---|---|
| PubChem CID | 101397283 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5-dimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol |
| SMILES | CO/C=C/[C@@]12C=CC[C@]1(O)[C@]1(C)C=C[C@]1(C)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3Si/c1-17(2,3)25(7,8)24-16-18(4)12-13-19(18,5)21(22)11-9-10-20(16,21)14-15-23-6/h9-10,12-16,22H,11H2,1-8H3/b15-14+/t16-,18+,19+,20+,21-/m0/s1 |
| InChIKey | NMEJDMFPQURMOQ-DCQUIELGSA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|