C26H27F5O4 — CID 101397290
(2,3,4,5,6-pentafluorophenyl)methyl (4Z)-4-methyl-2,14-dioxabicyclo[13.3.1]nonadeca-1(19),4,15,17-tetraene-16-carboxylate (PubChem CID 101397290) has the molecular formula C26H27F5O4 and a molecular weight of 498.49 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (4Z)-4-methyl-2,14-dioxabicyclo[13.3.1]nonadeca-1(19),4,15,17-tetraene-16-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (4Z)-4-methyl-2,14-dioxabicyclo[13.3.1]nonadeca-1(19),4,15,17-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 101397290 |
| Molecular Formula | C26H27F5O4 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (4Z)-4-methyl-2,14-dioxabicyclo[13.3.1]nonadeca-1(19),4,15,17-tetraene-16-carboxylate |
| SMILES | C/C1=C\CCCCCCCCOc2cc(ccc2C(=O)OCc2c(F)c(F)c(F)c(F)c2F)OC1 |
| InChI | InChI=1S/C26H27F5O4/c1-16-9-7-5-3-2-4-6-8-12-33-20-13-17(34-14-16)10-11-18(20)26(32)35-15-19-21(27)23(29)25(31)24(30)22(19)28/h9-11,13H,2-8,12,14-15H2,1H3/b16-9+ |
| InChIKey | PBHWHNIKNSCXEO-CXUHLZMHSA-N |
| XLogP | 7.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|