C25H18F6S2 — CID 101397458
2-ethyl-3-[2-(2-ethyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene (PubChem CID 101397458) has the molecular formula C25H18F6S2 and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-ethyl-3-[2-(2-ethyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene.
| Compound Name | 2-ethyl-3-[2-(2-ethyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene |
|---|---|
| PubChem CID | 101397458 |
| Molecular Formula | C25H18F6S2 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 2-ethyl-3-[2-(2-ethyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene |
| SMILES | CCc1sc2ccccc2c1C1=C(c2c(CC)sc3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C25H18F6S2/c1-3-15-19(13-9-5-7-11-17(13)32-15)21-22(24(28,29)25(30,31)23(21,26)27)20-14-10-6-8-12-18(14)33-16(20)4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | OIWFILZMJQYKCS-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|