C18H20N2OS2 — CID 101397997
trans-(1R,2S)-2-cyclopentyl-1-(4-sulfanylphenyl)-N-(1,3-thiazol-2-yl)cyclopropane-1-carboxamide (PubChem CID 101397997) has the molecular formula C18H20N2OS2 and a molecular weight of 344.50 g/mol. Its IUPAC name is trans-(1R,2S)-2-cyclopentyl-1-(4-sulfanylphenyl)-N-(1,3-thiazol-2-yl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2S)-2-cyclopentyl-1-(4-sulfanylphenyl)-N-(1,3-thiazol-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 101397997 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | trans-(1R,2S)-2-cyclopentyl-1-(4-sulfanylphenyl)-N-(1,3-thiazol-2-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nccs1)[C@]1(c2ccc(S)cc2)C[C@H]1C1CCCC1 |
| InChI | InChI=1S/C18H20N2OS2/c21-16(20-17-19-9-10-23-17)18(13-5-7-14(22)8-6-13)11-15(18)12-3-1-2-4-12/h5-10,12,15,22H,1-4,11H2,(H,19,20,21)/t15-,18-/m0/s1 |
| InChIKey | HMLXLTXKWNTDLZ-YJBOKZPZSA-N |
| XLogP | 4.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|