C33H27N3O9 — CID 101398134
(4S,7R)-2-[[3,5-bis[[(4R,7S)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]methyl]phenyl]methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 101398134) has the molecular formula C33H27N3O9 and a molecular weight of 609.59 g/mol. Its IUPAC name is (4S,7R)-2-[[3,5-bis[[(4R,7S)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]methyl]phenyl]methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (4S,7R)-2-[[3,5-bis[[(4R,7S)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]methyl]phenyl]methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 101398134 |
| Molecular Formula | C33H27N3O9 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | (4S,7R)-2-[[3,5-bis[[(4R,7S)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]methyl]phenyl]methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1C2C(C(=O)N1Cc1cc(CN3C(=O)C4C(C3=O)[C@H]3C=C[C@@H]4O3)cc(CN3C(=O)C4C(C3=O)[C@H]3C=C[C@@H]4O3)c1)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C33H27N3O9/c37-28-22-16-1-2-17(43-16)23(22)29(38)34(28)10-13-7-14(11-35-30(39)24-18-3-4-19(44-18)25(24)31(35)40)9-15(8-13)12-36-32(41)26-20-5-6-21(45-20)27(26)33(36)42/h1-9,16-27H,10-12H2/t16-,17+,18-,19+,20-,21+,22?,23?,24?,25?,26?,27? |
| InChIKey | TVLHRTXYKCJPGO-MVAVVEJHSA-N |
| XLogP | 0.00 |
| TPSA | 139.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|