C27H52O5Si — CID 101398238
methyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethylpropanoyloxy)-2-prop-2-enyldodecanoate (PubChem CID 101398238) has the molecular formula C27H52O5Si and a molecular weight of 484.79 g/mol. Its IUPAC name is methyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethylpropanoyloxy)-2-prop-2-enyldodecanoate.
| Compound Name | methyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethylpropanoyloxy)-2-prop-2-enyldodecanoate |
|---|---|
| PubChem CID | 101398238 |
| Molecular Formula | C27H52O5Si |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | methyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethylpropanoyloxy)-2-prop-2-enyldodecanoate |
| SMILES | C=CC[C@@H](C(=O)OC)[C@@H](CCCCCCCCCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O5Si/c1-11-19-22(24(28)30-8)23(32-33(9,10)27(5,6)7)20-17-15-13-12-14-16-18-21-31-25(29)26(2,3)4/h11,22-23H,1,12-21H2,2-10H3/t22-,23-/m1/s1 |
| InChIKey | ODYSEFQTYGWKDR-DHIUTWEWSA-N |
| XLogP | 7.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|