C16H24O3 — CID 101398285
(3S,3aR,7aR)-7a-methyl-2'-propan-2-yloxyspiro[1,2,3a,5,6,7-hexahydroindene-3,5'-2H-furan]-4-one (PubChem CID 101398285) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3S,3aR,7aR)-7a-methyl-2'-propan-2-yloxyspiro[1,2,3a,5,6,7-hexahydroindene-3,5'-2H-furan]-4-one.
| Compound Name | (3S,3aR,7aR)-7a-methyl-2'-propan-2-yloxyspiro[1,2,3a,5,6,7-hexahydroindene-3,5'-2H-furan]-4-one |
|---|---|
| PubChem CID | 101398285 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3S,3aR,7aR)-7a-methyl-2'-propan-2-yloxyspiro[1,2,3a,5,6,7-hexahydroindene-3,5'-2H-furan]-4-one |
| SMILES | CC(C)OC1C=C[C@]2(CC[C@@]3(C)CCCC(=O)[C@H]32)O1 |
| InChI | InChI=1S/C16H24O3/c1-11(2)18-13-6-8-16(19-13)10-9-15(3)7-4-5-12(17)14(15)16/h6,8,11,13-14H,4-5,7,9-10H2,1-3H3/t13?,14-,15-,16-/m1/s1 |
| InChIKey | KZNQDYPMKAAXHZ-VZMGZUMBSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|