C27H27FO6 — CID 10139836
2-ethyl-7-[3-(2-fluoro-4-phenoxyphenoxy)propoxy]-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 10139836) has the molecular formula C27H27FO6 and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-ethyl-7-[3-(2-fluoro-4-phenoxyphenoxy)propoxy]-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | 2-ethyl-7-[3-(2-fluoro-4-phenoxyphenoxy)propoxy]-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10139836 |
| Molecular Formula | C27H27FO6 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-ethyl-7-[3-(2-fluoro-4-phenoxyphenoxy)propoxy]-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCc2ccc(OCCCOc3ccc(Oc4ccccc4)cc3F)cc2O1 |
| InChI | InChI=1S/C27H27FO6/c1-2-27(26(29)30)14-13-19-9-10-21(18-25(19)34-27)31-15-6-16-32-24-12-11-22(17-23(24)28)33-20-7-4-3-5-8-20/h3-5,7-12,17-18H,2,6,13-16H2,1H3,(H,29,30) |
| InChIKey | AKDZHLYKWMYKAK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|