C23H25N5O4S — CID 10139903
8-(pentanoylamino)-1-(4-sulfamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 10139903) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is 8-(pentanoylamino)-1-(4-sulfamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-(pentanoylamino)-1-(4-sulfamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 10139903 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 8-(pentanoylamino)-1-(4-sulfamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CCCCC(=O)Nc1ccc2c(c1)-c1c(c(C(N)=O)nn1-c1ccc(S(N)(=O)=O)cc1)CC2 |
| InChI | InChI=1S/C23H25N5O4S/c1-2-3-4-20(29)26-15-7-5-14-6-12-18-21(23(24)30)27-28(22(18)19(14)13-15)16-8-10-17(11-9-16)33(25,31)32/h5,7-11,13H,2-4,6,12H2,1H3,(H2,24,30)(H,26,29)(H2,25,31,32) |
| InChIKey | AGHMTPHOMJFCMI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |