C16H32N2Si2 — CID 101399310
2,3,5,6-tetramethyl-4-N,4-N-bis(trimethylsilyl)benzene-1,4-diamine (PubChem CID 101399310) has the molecular formula C16H32N2Si2 and a molecular weight of 308.62 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-4-N,4-N-bis(trimethylsilyl)benzene-1,4-diamine.
| Compound Name | 2,3,5,6-tetramethyl-4-N,4-N-bis(trimethylsilyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 101399310 |
| Molecular Formula | C16H32N2Si2 |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2,3,5,6-tetramethyl-4-N,4-N-bis(trimethylsilyl)benzene-1,4-diamine |
| SMILES | Cc1c(C)c(N([Si](C)(C)C)[Si](C)(C)C)c(C)c(C)c1N |
| InChI | InChI=1S/C16H32N2Si2/c1-11-13(3)16(14(4)12(2)15(11)17)18(19(5,6)7)20(8,9)10/h17H2,1-10H3 |
| InChIKey | JWYHYJXJHCLEGV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|