C20H24NO5- — CID 101399341
(1R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 101399341) has the molecular formula C20H24NO5- and a molecular weight of 358.41 g/mol. Its IUPAC name is (1R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | (1R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 101399341 |
| Molecular Formula | C20H24NO5- |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (1R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | C[C@H]1C=C[C@H]2CCCC[C@@H]2[C@H]1C(=O)C1=C[C@]2(O)[C@H](C(=O)[O-])CCN2C1=O |
| InChI | InChI=1S/C20H25NO5/c1-11-6-7-12-4-2-3-5-13(12)16(11)17(22)14-10-20(26)15(19(24)25)8-9-21(20)18(14)23/h6-7,10-13,15-16,26H,2-5,8-9H2,1H3,(H,24,25)/p-1/t11-,12+,13-,15-,16-,20-/m0/s1 |
| InChIKey | BBYTXIIBHFYLLP-TWJOEMHWSA-M |
| XLogP | 0.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|