C25H23F3N4O2 — CID 10139951
4-[[4-[4-(2H-triazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole (PubChem CID 10139951) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is 4-[[4-[4-(2H-triazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole.
| Compound Name | 4-[[4-[4-(2H-triazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 10139951 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-[[4-[4-(2H-triazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole |
| SMILES | FC(F)(F)c1ccc(/C=C/c2nc(COc3ccc(CCCCc4cn[nH]n4)cc3)co2)cc1 |
| InChI | InChI=1S/C25H23F3N4O2/c26-25(27,28)20-10-5-19(6-11-20)9-14-24-30-22(17-34-24)16-33-23-12-7-18(8-13-23)3-1-2-4-21-15-29-32-31-21/h5-15,17H,1-4,16H2,(H,29,31,32)/b14-9+ |
| InChIKey | LAGKAKJVIDEPIW-NTEUORMPSA-N |
| XLogP | 6.13 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|