C17H18N2O2 — CID 101399870
(1S,7R,8R,12S)-10,10-dimethyl-3-phenyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2(6),4-diene (PubChem CID 101399870) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1S,7R,8R,12S)-10,10-dimethyl-3-phenyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2(6),4-diene.
| Compound Name | (1S,7R,8R,12S)-10,10-dimethyl-3-phenyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2(6),4-diene |
|---|---|
| PubChem CID | 101399870 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (1S,7R,8R,12S)-10,10-dimethyl-3-phenyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2(6),4-diene |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H]1C[C@H]2c2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2/c1-17(2)20-15-11-8-12(16(15)21-17)14-13(11)9-18-19(14)10-6-4-3-5-7-10/h3-7,9,11-12,15-16H,8H2,1-2H3/t11-,12+,15-,16+/m1/s1 |
| InChIKey | WRHRFIYCLXTHSI-KOZAUXTDSA-N |
| XLogP | 2.98 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |