C60H72N6 — CID 101400196
N-ethyl-N-methyl-4-[2,3,4,5,6-pentakis[4-[ethyl(methyl)amino]phenyl]phenyl]aniline (PubChem CID 101400196) has the molecular formula C60H72N6 and a molecular weight of 877.28 g/mol. Its IUPAC name is N-ethyl-N-methyl-4-[2,3,4,5,6-pentakis[4-[ethyl(methyl)amino]phenyl]phenyl]aniline.
| Compound Name | N-ethyl-N-methyl-4-[2,3,4,5,6-pentakis[4-[ethyl(methyl)amino]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 101400196 |
| Molecular Formula | C60H72N6 |
| Molecular Weight | 877.28 g/mol |
| Exact Mass | 876.58 |
| IUPAC Name | N-ethyl-N-methyl-4-[2,3,4,5,6-pentakis[4-[ethyl(methyl)amino]phenyl]phenyl]aniline |
| SMILES | CCN(C)c1ccc(-c2c(-c3ccc(N(C)CC)cc3)c(-c3ccc(N(C)CC)cc3)c(-c3ccc(N(C)CC)cc3)c(-c3ccc(N(C)CC)cc3)c2-c2ccc(N(C)CC)cc2)cc1 |
| InChI | InChI=1S/C60H72N6/c1-13-61(7)49-31-19-43(20-32-49)55-56(44-21-33-50(34-22-44)62(8)14-2)58(46-25-37-52(38-26-46)64(10)16-4)60(48-29-41-54(42-30-48)66(12)18-6)59(47-27-39-53(40-28-47)65(11)17-5)57(55)45-23-35-51(36-24-45)63(9)15-3/h19-42H,13-18H2,1-12H3 |
| InChIKey | RQYTXGZXSZIAPR-UHFFFAOYSA-N |
| XLogP | 14.43 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.28 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |