C26H23N5O4 — CID 10140026
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[2-(1H-imidazol-5-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 10140026) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[2-(1H-imidazol-5-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[2-(1H-imidazol-5-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 10140026 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[2-(1H-imidazol-5-yl)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1[C@H]2Cc3c([nH]c4ccccc34)[C@@H](c3ccc4c(c3)OCO4)N2C(=O)CN1CCc1cnc[nH]1 |
| InChI | InChI=1S/C26H23N5O4/c32-23-12-30(8-7-16-11-27-13-28-16)26(33)20-10-18-17-3-1-2-4-19(17)29-24(18)25(31(20)23)15-5-6-21-22(9-15)35-14-34-21/h1-6,9,11,13,20,25,29H,7-8,10,12,14H2,(H,27,28)/t20-,25-/m1/s1 |
| InChIKey | NNBKOONLNZAYEH-CJFMBICVSA-N |
| XLogP | 2.55 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|