C10H18O2 — CID 101400363
(1S,5R,7R)-5,7-diethyl-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 101400363) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (1S,5R,7R)-5,7-diethyl-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1S,5R,7R)-5,7-diethyl-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 101400363 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (1S,5R,7R)-5,7-diethyl-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | CC[C@H]1O[C@@]2(CC)CCC[C@@H]1O2 |
| InChI | InChI=1S/C10H18O2/c1-3-8-9-6-5-7-10(4-2,11-8)12-9/h8-9H,3-7H2,1-2H3/t8-,9+,10-/m1/s1 |
| InChIKey | SIIBZMKZDHWEQV-KXUCPTDWSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |