C20H35NO3Si2 — CID 101400716
(1-methoxy-2-phenyl-1-trimethylsilyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-2-yl)oxy-trimethylsilane (PubChem CID 101400716) has the molecular formula C20H35NO3Si2 and a molecular weight of 393.68 g/mol. Its IUPAC name is (1-methoxy-2-phenyl-1-trimethylsilyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-2-yl)oxy-trimethylsilane.
| Compound Name | (1-methoxy-2-phenyl-1-trimethylsilyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 101400716 |
| Molecular Formula | C20H35NO3Si2 |
| Molecular Weight | 393.68 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (1-methoxy-2-phenyl-1-trimethylsilyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-2-yl)oxy-trimethylsilane |
| SMILES | COC1(O[Si](C)(C)C)C2CCCN2CC1(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H35NO3Si2/c1-22-20(24-26(5,6)7)18-14-11-15-21(18)16-19(20,23-25(2,3)4)17-12-9-8-10-13-17/h8-10,12-13,18H,11,14-16H2,1-7H3 |
| InChIKey | KMVFJQPWCNPUEF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|