C44H48B2S2 — CID 101401200
8,19-dibutyl-11,22-bis(2,4,6-trimethylphenyl)-4,15-dithia-11,22-diborapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),6,8,13,16(21),17,19-nonaene (PubChem CID 101401200) has the molecular formula C44H48B2S2 and a molecular weight of 662.63 g/mol. Its IUPAC name is 8,19-dibutyl-11,22-bis(2,4,6-trimethylphenyl)-4,15-dithia-11,22-diborapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),6,8,13,16(21),17,19-nonaene.
| Compound Name | 8,19-dibutyl-11,22-bis(2,4,6-trimethylphenyl)-4,15-dithia-11,22-diborapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),6,8,13,16(21),17,19-nonaene |
|---|---|
| PubChem CID | 101401200 |
| Molecular Formula | C44H48B2S2 |
| Molecular Weight | 662.63 g/mol |
| Exact Mass | 662.34 |
| IUPAC Name | 8,19-dibutyl-11,22-bis(2,4,6-trimethylphenyl)-4,15-dithia-11,22-diborapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),6,8,13,16(21),17,19-nonaene |
| SMILES | CCCCc1ccc2c(c1)B(c1c(C)cc(C)cc1C)c1cc3c(cc1S2)B(c1c(C)cc(C)cc1C)c1cc(CCCC)ccc1S3 |
| InChI | InChI=1S/C44H48B2S2/c1-9-11-13-33-15-17-39-35(23-33)45(43-29(5)19-27(3)20-30(43)6)37-25-42-38(26-41(37)47-39)46(44-31(7)21-28(4)22-32(44)8)36-24-34(14-12-10-2)16-18-40(36)48-42/h15-26H,9-14H2,1-8H3 |
| InChIKey | QEAGCGNWIBNHDA-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.63 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|