C17H22O3 — CID 101401363
(3S,3aR,4'R,6aR,9aR,9bR)-4'-methyl-6,9-dimethylidenespiro[3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-3,2'-oxetane]-2-one (PubChem CID 101401363) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (3S,3aR,4'R,6aR,9aR,9bR)-4'-methyl-6,9-dimethylidenespiro[3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-3,2'-oxetane]-2-one.
| Compound Name | (3S,3aR,4'R,6aR,9aR,9bR)-4'-methyl-6,9-dimethylidenespiro[3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-3,2'-oxetane]-2-one |
|---|---|
| PubChem CID | 101401363 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (3S,3aR,4'R,6aR,9aR,9bR)-4'-methyl-6,9-dimethylidenespiro[3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-3,2'-oxetane]-2-one |
| SMILES | C=C1CC[C@H]2C(=C)CC[C@@H]3[C@H](OC(=O)[C@]34C[C@@H](C)O4)[C@@H]12 |
| InChI | InChI=1S/C17H22O3/c1-9-5-7-13-15(14-10(2)4-6-12(9)14)19-16(18)17(13)8-11(3)20-17/h11-15H,1-2,4-8H2,3H3/t11-,12+,13-,14+,15+,17+/m1/s1 |
| InChIKey | BBBCOILLJIFAEU-REISYBLGSA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|