About N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline
N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline (PubChem CID 101401389) has the molecular formula C14H11BrF3N
and a molecular weight of 330.15 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline.
Molecular Properties
| Compound Name | N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline |
| PubChem CID | 101401389 |
| Molecular Formula | C14H11BrF3N |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline |
| SMILES | FC(F)(F)C(Nc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H11BrF3N/c15-11-8-6-10(7-9-11)13(14(16,17)18)19-12-4-2-1-3-5-12/h1-9,13,19H |
| InChIKey | YLZYFBQSTMPFQP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline?
The IUPAC name of N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline (CID 101401389) is N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline.
What is the SMILES notation for N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline?
The canonical SMILES for N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline is FC(F)(F)C(Nc1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline?
The InChIKey is YLZYFBQSTMPFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrF3N/c15-11-8-6-10(7-9-11)13(14(16,17)18)19-12-4-2-1-3-5-12/h1-9,13,19H.
What are the key properties of N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline?
N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline has a molecular weight of 330.15 g/mol, XLogP of 5.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]aniline is sourced from PubChem (CID 101401389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).