C13H22O5 — CID 101401695
(2S,3R,4S,5R)-2-[(2E)-octa-2,7-dienoxy]oxane-3,4,5-triol (PubChem CID 101401695) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[(2E)-octa-2,7-dienoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[(2E)-octa-2,7-dienoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101401695 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2S,3R,4S,5R)-2-[(2E)-octa-2,7-dienoxy]oxane-3,4,5-triol |
| SMILES | C=CCCC/C=C/CO[C@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H22O5/c1-2-3-4-5-6-7-8-17-13-12(16)11(15)10(14)9-18-13/h2,6-7,10-16H,1,3-5,8-9H2/b7-6+/t10-,11+,12-,13+/m1/s1 |
| InChIKey | DITYCLLIXJZBKD-PCLQYLFHSA-N |
| XLogP | 0.35 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|