C16H20O6 — CID 101401921
(1R,2R,7S,8S)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 101401921) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (1R,2R,7S,8S)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | (1R,2R,7S,8S)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 101401921 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (1R,2R,7S,8S)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | COC1(OC)C(=O)C=C[C@@H]2[C@@H]1[C@H]1C=C[C@@H]2C(=O)C1(OC)OC |
| InChI | InChI=1S/C16H20O6/c1-19-15(20-2)11-7-5-10(14(15)18)9-6-8-12(17)16(21-3,22-4)13(9)11/h5-11,13H,1-4H3/t9-,10-,11+,13+/m0/s1 |
| InChIKey | ZJWGCDWAEKIAQE-MEWQQHAOSA-N |
| XLogP | 0.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|