About [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol
[2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol (PubChem CID 101402241) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol |
| PubChem CID | 101402241 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol |
| SMILES | CC1CC(CO)(CO)Cc2c1c1ccccc1n2C |
| InChI | InChI=1S/C16H21NO2/c1-11-7-16(9-18,10-19)8-14-15(11)12-5-3-4-6-13(12)17(14)2/h3-6,11,18-19H,7-10H2,1-2H3 |
| InChIKey | VDAFSFFEUUDTPY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol?
The IUPAC name of [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol (CID 101402241) is [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol.
What is the SMILES notation for [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol?
The canonical SMILES for [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol is CC1CC(CO)(CO)Cc2c1c1ccccc1n2C.
What is the InChIKey of [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol?
The InChIKey is VDAFSFFEUUDTPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-11-7-16(9-18,10-19)8-14-15(11)12-5-3-4-6-13(12)17(14)2/h3-6,11,18-19H,7-10H2,1-2H3.
What are the key properties of [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol?
[2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol has a molecular weight of 259.35 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-4,9-dimethyl-3,4-dihydro-1H-carbazol-2-yl]methanol is sourced from PubChem (CID 101402241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).