About S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate
S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate (PubChem CID 101402440) has the molecular formula C19H20N2O2S2
and a molecular weight of 372.52 g/mol. Its IUPAC name is S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate |
| PubChem CID | 101402440 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)SC1(SC(=O)N(C)C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H20N2O2S2/c1-20(2)17(22)24-19(25-18(23)21(3)4)15-11-7-5-9-13(15)14-10-6-8-12-16(14)19/h5-12H,1-4H3 |
| InChIKey | HBUUVTWCYNNFPD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate?
The IUPAC name of S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate (CID 101402440) is S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate.
What is the SMILES notation for S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate?
The canonical SMILES for S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate is CN(C)C(=O)SC1(SC(=O)N(C)C)c2ccccc2-c2ccccc21.
What is the InChIKey of S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate?
The InChIKey is HBUUVTWCYNNFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2S2/c1-20(2)17(22)24-19(25-18(23)21(3)4)15-11-7-5-9-13(15)14-10-6-8-12-16(14)19/h5-12H,1-4H3.
What are the key properties of S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate?
S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate has a molecular weight of 372.52 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[9-(dimethylcarbamoylsulfanyl)fluoren-9-yl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 101402440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).