C18H32O3Si — CID 101402681
ethyl (1R,2R,2aS,2bS,6aR,7aR)-1-methyl-1-trimethylsilyloxy-2,2a,2b,3,4,5,6,6a,7,7a-decahydrocyclobuta[a]indene-2-carboxylate (PubChem CID 101402681) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is ethyl (1R,2R,2aS,2bS,6aR,7aR)-1-methyl-1-trimethylsilyloxy-2,2a,2b,3,4,5,6,6a,7,7a-decahydrocyclobuta[a]indene-2-carboxylate.
| Compound Name | ethyl (1R,2R,2aS,2bS,6aR,7aR)-1-methyl-1-trimethylsilyloxy-2,2a,2b,3,4,5,6,6a,7,7a-decahydrocyclobuta[a]indene-2-carboxylate |
|---|---|
| PubChem CID | 101402681 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | ethyl (1R,2R,2aS,2bS,6aR,7aR)-1-methyl-1-trimethylsilyloxy-2,2a,2b,3,4,5,6,6a,7,7a-decahydrocyclobuta[a]indene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2[C@H]3CCCC[C@@H]3C[C@H]2[C@@]1(C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-6-20-17(19)16-15-13-10-8-7-9-12(13)11-14(15)18(16,2)21-22(3,4)5/h12-16H,6-11H2,1-5H3/t12-,13+,14-,15+,16+,18-/m1/s1 |
| InChIKey | ITUIWAJZKMOSHX-CAUAQDCSSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|