C24H15F5N2O3 — CID 10140295
3,4-bis(4-methoxyphenyl)-6-(2,3,4,5,6-pentafluorophenoxy)pyridazine (PubChem CID 10140295) has the molecular formula C24H15F5N2O3 and a molecular weight of 474.39 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenyl)-6-(2,3,4,5,6-pentafluorophenoxy)pyridazine.
| Compound Name | 3,4-bis(4-methoxyphenyl)-6-(2,3,4,5,6-pentafluorophenoxy)pyridazine |
|---|---|
| PubChem CID | 10140295 |
| Molecular Formula | C24H15F5N2O3 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 3,4-bis(4-methoxyphenyl)-6-(2,3,4,5,6-pentafluorophenoxy)pyridazine |
| SMILES | COc1ccc(-c2cc(Oc3c(F)c(F)c(F)c(F)c3F)nnc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H15F5N2O3/c1-32-14-7-3-12(4-8-14)16-11-17(30-31-23(16)13-5-9-15(33-2)10-6-13)34-24-21(28)19(26)18(25)20(27)22(24)29/h3-11H,1-2H3 |
| InChIKey | JLEPZUZKHQGZAQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|