C23H19NO2 — CID 101403657
(6R,9R)-8-benzyl-5-oxa-8-azatricyclo[12.4.0.06,9]octadeca-1(18),14,16-trien-2,12-diyn-7-one (PubChem CID 101403657) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is (6R,9R)-8-benzyl-5-oxa-8-azatricyclo[12.4.0.06,9]octadeca-1(18),14,16-trien-2,12-diyn-7-one.
| Compound Name | (6R,9R)-8-benzyl-5-oxa-8-azatricyclo[12.4.0.06,9]octadeca-1(18),14,16-trien-2,12-diyn-7-one |
|---|---|
| PubChem CID | 101403657 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (6R,9R)-8-benzyl-5-oxa-8-azatricyclo[12.4.0.06,9]octadeca-1(18),14,16-trien-2,12-diyn-7-one |
| SMILES | O=C1[C@@H]2OCC#Cc3ccccc3C#CCC[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C23H19NO2/c25-23-22-21(24(23)17-18-9-2-1-3-10-18)15-7-6-13-19-11-4-5-12-20(19)14-8-16-26-22/h1-5,9-12,21-22H,7,15-17H2/t21-,22-/m1/s1 |
| InChIKey | SMTKFYXXIIDKCK-FGZHOGPDSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|