C27H25N5O — CID 101403706
2-[3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 101403706) has the molecular formula C27H25N5O and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 101403706 |
| Molecular Formula | C27H25N5O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-[3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | CN(C)c1ccc(/C=C/C23OCCN2c2ccc(C(C#N)=C(C#N)C#N)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C27H25N5O/c1-26(2)24-15-20(23(18-30)21(16-28)17-29)7-10-25(24)32-13-14-33-27(26,32)12-11-19-5-8-22(9-6-19)31(3)4/h5-12,15H,13-14H2,1-4H3/b12-11+ |
| InChIKey | DIOKTUIGSJPILL-VAWYXSNFSA-N |
| XLogP | 4.61 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|