C21H16F4N6O3 — CID 10140408
[6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 10140408) has the molecular formula C21H16F4N6O3 and a molecular weight of 476.39 g/mol. Its IUPAC name is [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 10140408 |
| Molecular Formula | C21H16F4N6O3 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(=O)N(c1ccc(COC(=O)N=C(N)N)c(-c2ccc(F)cc2F)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C21H16F4N6O3/c22-11-5-6-12(15(25)8-11)17-10(9-34-21(33)30-19(26)27)4-7-16(29-17)31(20(28)32)18-13(23)2-1-3-14(18)24/h1-8H,9H2,(H2,28,32)(H4,26,27,30,33) |
| InChIKey | JTFKDRYUQASCBT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|