C23H34O5 — CID 101404192
[(1S,3aS,4S,5S,7aS)-5-acetyl-4-[2-[(4S)-4-acetyloxycyclopenten-1-yl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate (PubChem CID 101404192) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(1S,3aS,4S,5S,7aS)-5-acetyl-4-[2-[(4S)-4-acetyloxycyclopenten-1-yl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate.
| Compound Name | [(1S,3aS,4S,5S,7aS)-5-acetyl-4-[2-[(4S)-4-acetyloxycyclopenten-1-yl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate |
|---|---|
| PubChem CID | 101404192 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(1S,3aS,4S,5S,7aS)-5-acetyl-4-[2-[(4S)-4-acetyloxycyclopenten-1-yl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C(CC[C@@H]2[C@@H](C(C)=O)CC[C@]3(C)[C@@H](OC(C)=O)CC[C@@H]23)C1 |
| InChI | InChI=1S/C23H34O5/c1-14(24)19-11-12-23(4)21(9-10-22(23)28-16(3)26)20(19)8-6-17-5-7-18(13-17)27-15(2)25/h5,18-22H,6-13H2,1-4H3/t18-,19+,20+,21-,22-,23-/m0/s1 |
| InChIKey | AGQMNWHUOKEGGZ-GOMYTPFNSA-N |
| XLogP | 4.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|