C23H25ClN2O3S2 — CID 10140461
cis-(1R,2R)-2-[[4-[(2-chlorophenyl)methylsulfanyl]phenyl]sulfonylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide (PubChem CID 10140461) has the molecular formula C23H25ClN2O3S2 and a molecular weight of 477.05 g/mol. Its IUPAC name is cis-(1R,2R)-2-[[4-[(2-chlorophenyl)methylsulfanyl]phenyl]sulfonylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-2-[[4-[(2-chlorophenyl)methylsulfanyl]phenyl]sulfonylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10140461 |
| Molecular Formula | C23H25ClN2O3S2 |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | cis-(1R,2R)-2-[[4-[(2-chlorophenyl)methylsulfanyl]phenyl]sulfonylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1CCCC[C@H]1CS(=O)(=O)c1ccc(SCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClN2O3S2/c24-22-8-4-2-5-17(22)15-30-19-9-11-20(12-10-19)31(28,29)16-18-6-1-3-7-21(18)23(27)26-14-13-25/h2,4-5,8-12,18,21H,1,3,6-7,14-16H2,(H,26,27)/t18-,21+/m0/s1 |
| InChIKey | FXWQDSKHVVINFT-GHTZIAJQSA-N |
| XLogP | 4.85 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|