C11H17ClO2 — CID 101404708
(3aS,7R,7aR)-7-chloro-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-1-benzofuran-2-one (PubChem CID 101404708) has the molecular formula C11H17ClO2 and a molecular weight of 216.71 g/mol. Its IUPAC name is (3aS,7R,7aR)-7-chloro-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-1-benzofuran-2-one.
| Compound Name | (3aS,7R,7aR)-7-chloro-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 101404708 |
| Molecular Formula | C11H17ClO2 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (3aS,7R,7aR)-7-chloro-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-1-benzofuran-2-one |
| SMILES | CC1(C)C[C@@H](Cl)[C@@H]2OC(=O)C[C@]2(C)C1 |
| InChI | InChI=1S/C11H17ClO2/c1-10(2)4-7(12)9-11(3,6-10)5-8(13)14-9/h7,9H,4-6H2,1-3H3/t7-,9+,11-/m1/s1 |
| InChIKey | XQEKZHWCKJTKTI-POZPLHJXSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|