C10H10F5N — CID 101404764
N,N-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)ethanamine (PubChem CID 101404764) has the molecular formula C10H10F5N and a molecular weight of 239.19 g/mol. Its IUPAC name is N,N-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)ethanamine.
| Compound Name | N,N-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)ethanamine |
|---|---|
| PubChem CID | 101404764 |
| Molecular Formula | C10H10F5N |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N,N-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)ethanamine |
| SMILES | CN(C)CCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5N/c1-16(2)4-3-5-6(11)8(13)10(15)9(14)7(5)12/h3-4H2,1-2H3 |
| InChIKey | XMVPAHMCFSGEGH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|