About 2-ethyl-1,3,7-trimethylfluoren-9-one
2-ethyl-1,3,7-trimethylfluoren-9-one (PubChem CID 101404814) has the molecular formula C18H18O
and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-ethyl-1,3,7-trimethylfluoren-9-one.
Molecular Properties
| Compound Name | 2-ethyl-1,3,7-trimethylfluoren-9-one |
| PubChem CID | 101404814 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-ethyl-1,3,7-trimethylfluoren-9-one |
| SMILES | CCc1c(C)cc2c(c1C)C(=O)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C18H18O/c1-5-13-11(3)9-15-14-7-6-10(2)8-16(14)18(19)17(15)12(13)4/h6-9H,5H2,1-4H3 |
| InChIKey | DLLPVCLZYSZQSB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1,3,7-trimethylfluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3,7-trimethylfluoren-9-one?
The IUPAC name of 2-ethyl-1,3,7-trimethylfluoren-9-one (CID 101404814) is 2-ethyl-1,3,7-trimethylfluoren-9-one.
What is the SMILES notation for 2-ethyl-1,3,7-trimethylfluoren-9-one?
The canonical SMILES for 2-ethyl-1,3,7-trimethylfluoren-9-one is CCc1c(C)cc2c(c1C)C(=O)c1cc(C)ccc1-2.
What is the InChIKey of 2-ethyl-1,3,7-trimethylfluoren-9-one?
The InChIKey is DLLPVCLZYSZQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O/c1-5-13-11(3)9-15-14-7-6-10(2)8-16(14)18(19)17(15)12(13)4/h6-9H,5H2,1-4H3.
What are the key properties of 2-ethyl-1,3,7-trimethylfluoren-9-one?
2-ethyl-1,3,7-trimethylfluoren-9-one has a molecular weight of 250.34 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3,7-trimethylfluoren-9-one is sourced from PubChem (CID 101404814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).