About CID 101404869
CID 101404869 (PubChem CID 101404869) has the molecular formula C20H17Se2
and a molecular weight of 415.28 g/mol.
Molecular Properties
| Compound Name | CID 101404869 |
| PubChem CID | 101404869 |
| Molecular Formula | C20H17Se2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | — |
| SMILES | [c]1c(C[Se]c2ccccc2)cccc1C[Se]c1ccccc1 |
| InChI | InChI=1S/C20H17Se2/c1-3-10-19(11-4-1)21-15-17-8-7-9-18(14-17)16-22-20-12-5-2-6-13-20/h1-13H,15-16H2 |
| InChIKey | LUUUBNQVTGKDLG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 101404869 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101404869?
The IUPAC name of CID 101404869 (CID 101404869) is not available.
What is the SMILES notation for CID 101404869?
The canonical SMILES for CID 101404869 is [c]1c(C[Se]c2ccccc2)cccc1C[Se]c1ccccc1.
What is the InChIKey of CID 101404869?
The InChIKey is LUUUBNQVTGKDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Se2/c1-3-10-19(11-4-1)21-15-17-8-7-9-18(14-17)16-22-20-12-5-2-6-13-20/h1-13H,15-16H2.
What are the key properties of CID 101404869?
CID 101404869 has a molecular weight of 415.28 g/mol, XLogP of 2.55, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101404869 is sourced from PubChem (CID 101404869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).