C28H31NO4S — CID 10140505
(2S,3R)-2-[4-[2-[(2R,3S)-2,3-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol (PubChem CID 10140505) has the molecular formula C28H31NO4S and a molecular weight of 477.63 g/mol. Its IUPAC name is (2S,3R)-2-[4-[2-[(2R,3S)-2,3-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol.
| Compound Name | (2S,3R)-2-[4-[2-[(2R,3S)-2,3-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol |
|---|---|
| PubChem CID | 10140505 |
| Molecular Formula | C28H31NO4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | (2S,3R)-2-[4-[2-[(2R,3S)-2,3-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol |
| SMILES | C[C@@H]1[C@@H](C)CCN1CCOc1ccc([C@@H]2Oc3ccc(O)cc3S[C@@H]2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C28H31NO4S/c1-18-13-14-29(19(18)2)15-16-32-24-10-5-20(6-11-24)27-28(21-3-7-22(30)8-4-21)34-26-17-23(31)9-12-25(26)33-27/h3-12,17-19,27-28,30-31H,13-16H2,1-2H3/t18-,19+,27-,28+/m0/s1 |
| InChIKey | HPHROQFCKDXRCU-WZZYAGEBSA-N |
| XLogP | 6.17 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |