C18H38N6 — CID 101405087
1-N,1-N',4-N,4-N'-tetra(propan-2-yl)piperazine-1,4-dicarboximidamide (PubChem CID 101405087) has the molecular formula C18H38N6 and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-N,1-N',4-N,4-N'-tetra(propan-2-yl)piperazine-1,4-dicarboximidamide.
| Compound Name | 1-N,1-N',4-N,4-N'-tetra(propan-2-yl)piperazine-1,4-dicarboximidamide |
|---|---|
| PubChem CID | 101405087 |
| Molecular Formula | C18H38N6 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 1-N,1-N',4-N,4-N'-tetra(propan-2-yl)piperazine-1,4-dicarboximidamide |
| SMILES | CC(C)/N=C(/NC(C)C)N1CCN(/C(=N\C(C)C)NC(C)C)CC1 |
| InChI | InChI=1S/C18H38N6/c1-13(2)19-17(20-14(3)4)23-9-11-24(12-10-23)18(21-15(5)6)22-16(7)8/h13-16H,9-12H2,1-8H3,(H,19,20)(H,21,22) |
| InChIKey | KTPKBAAUZWDCLE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|