C22H30N6 — CID 101405110
(E)-N,N'-diethyl-N,N'-bis[(4-methylphenyl)diazenyl]but-2-ene-1,4-diamine (PubChem CID 101405110) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is (E)-N,N'-diethyl-N,N'-bis[(4-methylphenyl)diazenyl]but-2-ene-1,4-diamine.
| Compound Name | (E)-N,N'-diethyl-N,N'-bis[(4-methylphenyl)diazenyl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 101405110 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | (E)-N,N'-diethyl-N,N'-bis[(4-methylphenyl)diazenyl]but-2-ene-1,4-diamine |
| SMILES | CCN(C/C=C/CN(CC)/N=N/c1ccc(C)cc1)/N=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30N6/c1-5-27(25-23-21-13-9-19(3)10-14-21)17-7-8-18-28(6-2)26-24-22-15-11-20(4)12-16-22/h7-16H,5-6,17-18H2,1-4H3/b8-7+,25-23+,26-24+ |
| InChIKey | YQLJGJHKDYKHOT-XPFLWABXSA-N |
| XLogP | 6.20 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|