C20H24Br2N6 — CID 101405111
(E)-N,N'-bis[(4-bromophenyl)diazenyl]-N,N'-diethylbut-2-ene-1,4-diamine (PubChem CID 101405111) has the molecular formula C20H24Br2N6 and a molecular weight of 508.26 g/mol. Its IUPAC name is (E)-N,N'-bis[(4-bromophenyl)diazenyl]-N,N'-diethylbut-2-ene-1,4-diamine.
| Compound Name | (E)-N,N'-bis[(4-bromophenyl)diazenyl]-N,N'-diethylbut-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 101405111 |
| Molecular Formula | C20H24Br2N6 |
| Molecular Weight | 508.26 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | (E)-N,N'-bis[(4-bromophenyl)diazenyl]-N,N'-diethylbut-2-ene-1,4-diamine |
| SMILES | CCN(C/C=C/CN(CC)/N=N/c1ccc(Br)cc1)/N=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H24Br2N6/c1-3-27(25-23-19-11-7-17(21)8-12-19)15-5-6-16-28(4-2)26-24-20-13-9-18(22)10-14-20/h5-14H,3-4,15-16H2,1-2H3/b6-5+,25-23+,26-24+ |
| InChIKey | DDBDYTVDDRQAST-SSRVRESHSA-N |
| XLogP | 7.11 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.26 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|