C14H26OSi — CID 101405697
1-[(E)-3-[dimethyl(prop-2-enyl)silyl]prop-2-enyl]cyclohexan-1-ol (PubChem CID 101405697) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is 1-[(E)-3-[dimethyl(prop-2-enyl)silyl]prop-2-enyl]cyclohexan-1-ol.
| Compound Name | 1-[(E)-3-[dimethyl(prop-2-enyl)silyl]prop-2-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 101405697 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-[(E)-3-[dimethyl(prop-2-enyl)silyl]prop-2-enyl]cyclohexan-1-ol |
| SMILES | C=CC[Si](C)(C)/C=C/CC1(O)CCCCC1 |
| InChI | InChI=1S/C14H26OSi/c1-4-12-16(2,3)13-8-11-14(15)9-6-5-7-10-14/h4,8,13,15H,1,5-7,9-12H2,2-3H3/b13-8+ |
| InChIKey | DKQFBUYIMSAWGL-MDWZMJQESA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|