C16H17F3N5O5PS — CID 10140579
3-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]propyl 2,2,2-trifluoroethyl hydrogen phosphate (PubChem CID 10140579) has the molecular formula C16H17F3N5O5PS and a molecular weight of 479.38 g/mol. Its IUPAC name is 3-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]propyl 2,2,2-trifluoroethyl hydrogen phosphate.
| Compound Name | 3-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]propyl 2,2,2-trifluoroethyl hydrogen phosphate |
|---|---|
| PubChem CID | 10140579 |
| Molecular Formula | C16H17F3N5O5PS |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 3-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]propyl 2,2,2-trifluoroethyl hydrogen phosphate |
| SMILES | Nc1nc(Sc2cccc(O)c2)c2ncn(CCCOP(=O)(O)OCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C16H17F3N5O5PS/c17-16(18,19)8-29-30(26,27)28-6-2-5-24-9-21-12-13(24)22-15(20)23-14(12)31-11-4-1-3-10(25)7-11/h1,3-4,7,9,25H,2,5-6,8H2,(H,26,27)(H2,20,22,23) |
| InChIKey | DKZNFNYIPWAVCU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|