About 2-octylazulene
2-octylazulene (PubChem CID 101406191) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-octylazulene.
Molecular Properties
| Compound Name | 2-octylazulene |
| PubChem CID | 101406191 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-octylazulene |
| SMILES | CCCCCCCCc1cc2cccccc-2c1 |
| InChI | InChI=1S/C18H24/c1-2-3-4-5-6-8-11-16-14-17-12-9-7-10-13-18(17)15-16/h7,9-10,12-15H,2-6,8,11H2,1H3 |
| InChIKey | HOGXZSUPVNIGBN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylazulene?
The IUPAC name of 2-octylazulene (CID 101406191) is 2-octylazulene.
What is the SMILES notation for 2-octylazulene?
The canonical SMILES for 2-octylazulene is CCCCCCCCc1cc2cccccc-2c1.
What is the InChIKey of 2-octylazulene?
The InChIKey is HOGXZSUPVNIGBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24/c1-2-3-4-5-6-8-11-16-14-17-12-9-7-10-13-18(17)15-16/h7,9-10,12-15H,2-6,8,11H2,1H3.
What are the key properties of 2-octylazulene?
2-octylazulene has a molecular weight of 240.39 g/mol, XLogP of 5.69, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylazulene is sourced from PubChem (CID 101406191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).