About 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one
8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one (PubChem CID 101406491) has the molecular formula C20H8O2S4
and a molecular weight of 408.55 g/mol. Its IUPAC name is 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one.
Molecular Properties
| Compound Name | 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one |
| PubChem CID | 101406491 |
| Molecular Formula | C20H8O2S4 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one |
| SMILES | O=C1c2ccsc2C(=C2c3sccc3C(=O)c3ccsc32)c2sccc21 |
| InChI | InChI=1S/C20H8O2S4/c21-15-9-1-5-23-17(9)13(18-10(15)2-6-24-18)14-19-11(3-7-25-19)16(22)12-4-8-26-20(12)14/h1-8H |
| InChIKey | BBCRKYDYICDKPG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one?
The IUPAC name of 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one (CID 101406491) is 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one.
What is the SMILES notation for 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one?
The canonical SMILES for 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one is O=C1c2ccsc2C(=C2c3sccc3C(=O)c3ccsc32)c2sccc21.
What is the InChIKey of 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one?
The InChIKey is BBCRKYDYICDKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H8O2S4/c21-15-9-1-5-23-17(9)13(18-10(15)2-6-24-18)14-19-11(3-7-25-19)16(22)12-4-8-26-20(12)14/h1-8H.
What are the key properties of 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one?
8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one has a molecular weight of 408.55 g/mol, XLogP of 6.03, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-oxothieno[3,2-f][1]benzothiol-8-ylidene)thieno[3,2-f][1]benzothiol-4-one is sourced from PubChem (CID 101406491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).