C24H25N3O — CID 101406560
2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline (PubChem CID 101406560) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline.
| Compound Name | 2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline |
|---|---|
| PubChem CID | 101406560 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-[2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]anilino]phenyl]aniline |
| SMILES | CC(C)[C@H]1COC(c2ccccc2Nc2ccccc2-c2ccccc2N)=N1 |
| InChI | InChI=1S/C24H25N3O/c1-16(2)23-15-28-24(27-23)19-11-5-8-14-22(19)26-21-13-7-4-10-18(21)17-9-3-6-12-20(17)25/h3-14,16,23,26H,15,25H2,1-2H3/t23-/m1/s1 |
| InChIKey | VCVYXXVELJUZHH-HSZRJFAPSA-N |
| XLogP | 5.48 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|