C14H25N5+2 — CID 101406732
4-butyl-1-[(3-butylimidazol-1-ium-1-yl)methyl]-1,2,4-triazol-4-ium (PubChem CID 101406732) has the molecular formula C14H25N5+2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 4-butyl-1-[(3-butylimidazol-1-ium-1-yl)methyl]-1,2,4-triazol-4-ium.
| Compound Name | 4-butyl-1-[(3-butylimidazol-1-ium-1-yl)methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 101406732 |
| Molecular Formula | C14H25N5+2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 4-butyl-1-[(3-butylimidazol-1-ium-1-yl)methyl]-1,2,4-triazol-4-ium |
| SMILES | CCCCn1cc[n+](Cn2c[n+](CCCC)cn2)c1 |
| InChI | InChI=1S/C14H25N5/c1-3-5-7-16-9-10-18(12-16)14-19-13-17(11-15-19)8-6-4-2/h9-13H,3-8,14H2,1-2H3/q+2 |
| InChIKey | SFLXPVBKJMUUPK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 30.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|