C15H7F7S — CID 101407126
4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-2-phenylthiophene (PubChem CID 101407126) has the molecular formula C15H7F7S and a molecular weight of 352.27 g/mol. Its IUPAC name is 4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-2-phenylthiophene.
| Compound Name | 4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-2-phenylthiophene |
|---|---|
| PubChem CID | 101407126 |
| Molecular Formula | C15H7F7S |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-2-phenylthiophene |
| SMILES | FC1=C(c2csc(-c3ccccc3)c2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H7F7S/c16-12-11(13(17,18)15(21,22)14(12,19)20)9-6-10(23-7-9)8-4-2-1-3-5-8/h1-7H |
| InChIKey | DEQYOJVBYKTLBA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|